C13H22N2O2 — CID 178085358
2,4-dimethyl-5,6-dihydroisoindole-1,3-dione;ethane;methanamine (PubChem CID 178085358) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,4-dimethyl-5,6-dihydroisoindole-1,3-dione;ethane;methanamine.
| Compound Name | 2,4-dimethyl-5,6-dihydroisoindole-1,3-dione;ethane;methanamine |
|---|---|
| PubChem CID | 178085358 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2,4-dimethyl-5,6-dihydroisoindole-1,3-dione;ethane;methanamine |
| SMILES | CC.CC1=C2C(=O)N(C)C(=O)C2=CCC1.CN |
| InChI | InChI=1S/C10H11NO2.C2H6.CH5N/c1-6-4-3-5-7-8(6)10(13)11(2)9(7)12;2*1-2/h5H,3-4H2,1-2H3;1-2H3;2H2,1H3 |
| InChIKey | IUZVAENPQOPLKU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|