C24H32N2O6 — CID 174113283
4-methyl-2-[(6Z)-2-oxo-6-(1,4,7-trioxacyclotridec-10-ylidene)piperidin-3-yl]-5,6-dihydroisoindole-1,3-dione (PubChem CID 174113283) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-methyl-2-[(6Z)-2-oxo-6-(1,4,7-trioxacyclotridec-10-ylidene)piperidin-3-yl]-5,6-dihydroisoindole-1,3-dione.
| Compound Name | 4-methyl-2-[(6Z)-2-oxo-6-(1,4,7-trioxacyclotridec-10-ylidene)piperidin-3-yl]-5,6-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 174113283 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-methyl-2-[(6Z)-2-oxo-6-(1,4,7-trioxacyclotridec-10-ylidene)piperidin-3-yl]-5,6-dihydroisoindole-1,3-dione |
| SMILES | CC1=C2C(=O)N(C3CC/C(=C4\CCCOCCOCCOCC4)NC3=O)C(=O)C2=CCC1 |
| InChI | InChI=1S/C24H32N2O6/c1-16-4-2-6-18-21(16)24(29)26(23(18)28)20-8-7-19(25-22(20)27)17-5-3-10-30-12-14-32-15-13-31-11-9-17/h6,20H,2-5,7-15H2,1H3,(H,25,27)/b19-17- |
| InChIKey | RISISBYSADCLOV-ZPHPHTNESA-N |
| XLogP | 2.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|