C6H5N3S — CID 163251322
1,7-dihydropyrazolo[5,4-b]pyridine-6-thione (PubChem CID 163251322) has the molecular formula C6H5N3S and a molecular weight of 151.19 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[5,4-b]pyridine-6-thione.
| Compound Name | 1,7-dihydropyrazolo[5,4-b]pyridine-6-thione |
|---|---|
| PubChem CID | 163251322 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 1,7-dihydropyrazolo[5,4-b]pyridine-6-thione |
| SMILES | S=c1ccc2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C6H5N3S/c10-5-2-1-4-3-7-9-6(4)8-5/h1-3H,(H2,7,8,9,10) |
| InChIKey | GVTVEVYXZLOUJG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|