C11H21F2N — CID 163256389
(2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine;methane (PubChem CID 163256389) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine;methane.
| Compound Name | (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine;methane |
|---|---|
| PubChem CID | 163256389 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine;methane |
| SMILES | C.CC=C(C)[C@@H]1CCCN1CC(F)F |
| InChI | InChI=1S/C10H17F2N.CH4/c1-3-8(2)9-5-4-6-13(9)7-10(11)12;/h3,9-10H,4-7H2,1-2H3;1H4/t9-;/m0./s1 |
| InChIKey | WUYIKFJHPCNGBK-FVGYRXGTSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|