C10H17F2N — CID 163256390
(2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine (PubChem CID 163256390) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine.
| Compound Name | (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine |
|---|---|
| PubChem CID | 163256390 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (2S)-2-but-2-en-2-yl-1-(2,2-difluoroethyl)pyrrolidine |
| SMILES | CC=C(C)[C@@H]1CCCN1CC(F)F |
| InChI | InChI=1S/C10H17F2N/c1-3-8(2)9-5-4-6-13(9)7-10(11)12/h3,9-10H,4-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | TVZBXQUNSFKGKF-VIFPVBQESA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|