C23H20BrF3N2O3 — CID 163259770
N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxamide (PubChem CID 163259770) has the molecular formula C23H20BrF3N2O3 and a molecular weight of 509.32 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 163259770 |
| Molecular Formula | C23H20BrF3N2O3 |
| Molecular Weight | 509.32 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(Br)cc1)C(F)(F)F)C1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H20BrF3N2O3/c24-15-9-5-13(6-10-15)19(23(25,26)27)28-20(30)14-7-11-16(12-8-14)29-21(31)17-3-1-2-4-18(17)22(29)32/h1-6,9-10,14,16,19H,7-8,11-12H2,(H,28,30)/t14?,16?,19-/m0/s1 |
| InChIKey | VBIMALXNRGBWGZ-KJXMEXGPSA-N |
| XLogP | 5.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|