C30H32N2O8 — CID 163265499
(2,5-dioxopyrrolidin-1-yl) 3-[2-[6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3,6-dioxohexoxy]ethoxy]propanoate (PubChem CID 163265499) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3,6-dioxohexoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3,6-dioxohexoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 163265499 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3,6-dioxohexoxy]ethoxy]propanoate |
| SMILES | O=C(CCOCCOCCC(=O)ON1C(=O)CCC1=O)CCC(=O)N1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C30H32N2O8/c33-25(15-17-38-19-20-39-18-16-30(37)40-32-28(35)13-14-29(32)36)11-12-27(34)31-21-24-7-2-1-5-22(24)9-10-23-6-3-4-8-26(23)31/h1-10H,11-21H2/b10-9- |
| InChIKey | AWQJPFDXRNZTGS-KTKRTIGZSA-N |
| XLogP | 3.47 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|