C9H10F3O4P — CID 163265576
[3,3-difluoro-1-(4-fluorophenyl)propyl] dihydrogen phosphate (PubChem CID 163265576) has the molecular formula C9H10F3O4P and a molecular weight of 270.14 g/mol. Its IUPAC name is [3,3-difluoro-1-(4-fluorophenyl)propyl] dihydrogen phosphate.
| Compound Name | [3,3-difluoro-1-(4-fluorophenyl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 163265576 |
| Molecular Formula | C9H10F3O4P |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [3,3-difluoro-1-(4-fluorophenyl)propyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(CC(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H10F3O4P/c10-7-3-1-6(2-4-7)8(5-9(11)12)16-17(13,14)15/h1-4,8-9H,5H2,(H2,13,14,15) |
| InChIKey | ADLCKAWNBIWLCL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|