C29H38N4O7 — CID 163268608
tert-butyl 4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-(4-oxobutyl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 163268608) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-(4-oxobutyl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-(4-oxobutyl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163268608 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | tert-butyl 4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-(4-oxobutyl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCN(CCCC=O)c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C29H38N4O7/c1-29(2,3)40-28(39)32-16-12-19(13-17-32)11-15-31(14-4-5-18-34)21-8-6-7-20-24(21)27(38)33(26(20)37)22-9-10-23(35)30-25(22)36/h6-8,18-19,22H,4-5,9-17H2,1-3H3,(H,30,35,36) |
| InChIKey | XJBNGIVBSDABBG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|