C33H51F2N7O6S — CID 163278229
tert-butyl N-[1-[2-[[6-[5-[1-[butoxysulfanyl(ethyl)amino]ethyl]-2-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6-difluoroheptan-3-yl]carbamate (PubChem CID 163278229) has the molecular formula C33H51F2N7O6S and a molecular weight of 711.88 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[[6-[5-[1-[butoxysulfanyl(ethyl)amino]ethyl]-2-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6-difluoroheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[[6-[5-[1-[butoxysulfanyl(ethyl)amino]ethyl]-2-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6-difluoroheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 163278229 |
| Molecular Formula | C33H51F2N7O6S |
| Molecular Weight | 711.88 g/mol |
| Exact Mass | 711.36 |
| IUPAC Name | tert-butyl N-[1-[2-[[6-[5-[1-[butoxysulfanyl(ethyl)amino]ethyl]-2-methoxy-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6-difluoroheptan-3-yl]carbamate |
| SMILES | CCCCOSN(CC)C(C)c1cnc(OC)c(-c2cn3ncnc3c(OCCOCCC(CCC(C)(F)F)NC(=O)OC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C33H51F2N7O6S/c1-9-11-15-47-49-42(10-2)23(3)24-19-26(29(44-8)36-20-24)27-21-41-28(37-22-38-41)30(40-27)46-18-17-45-16-13-25(12-14-33(7,34)35)39-31(43)48-32(4,5)6/h19-23,25H,9-18H2,1-8H3,(H,39,43) |
| InChIKey | CWHBEMWNQJCMTR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.88 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|