C33H51F2N7O5S — CID 163278887
tert-butyl N-[(2S)-1-[3-[[6-[2-[(1R)-1-[tert-butylsulfinyl(ethyl)amino]ethyl]-5-methyl-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]propoxy]-5,5-difluorohexan-2-yl]carbamate (PubChem CID 163278887) has the molecular formula C33H51F2N7O5S and a molecular weight of 695.88 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3-[[6-[2-[(1R)-1-[tert-butylsulfinyl(ethyl)amino]ethyl]-5-methyl-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]propoxy]-5,5-difluorohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3-[[6-[2-[(1R)-1-[tert-butylsulfinyl(ethyl)amino]ethyl]-5-methyl-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]propoxy]-5,5-difluorohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 163278887 |
| Molecular Formula | C33H51F2N7O5S |
| Molecular Weight | 695.88 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3-[[6-[2-[(1R)-1-[tert-butylsulfinyl(ethyl)amino]ethyl]-5-methyl-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]propoxy]-5,5-difluorohexan-2-yl]carbamate |
| SMILES | CCN([C@H](C)c1cc(-c2cn3ncnc3c(OCCCOC[C@H](CCC(C)(F)F)NC(=O)OC(C)(C)C)n2)c(C)cn1)S(=O)C(C)(C)C |
| InChI | InChI=1S/C33H51F2N7O5S/c1-11-42(48(44)32(7,8)9)23(3)26-17-25(22(2)18-36-26)27-19-41-28(37-21-38-41)29(40-27)46-16-12-15-45-20-24(13-14-33(10,34)35)39-30(43)47-31(4,5)6/h17-19,21,23-24H,11-16,20H2,1-10H3,(H,39,43)/t23-,24+,48?/m1/s1 |
| InChIKey | UOFZZWALBVKOEN-BASKDVLXSA-N |
| XLogP | 6.45 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.88 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|