C13H22FN3O2 — CID 163281639
6-(fluoromethyl)-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 163281639) has the molecular formula C13H22FN3O2 and a molecular weight of 271.34 g/mol. Its IUPAC name is 6-(fluoromethyl)-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-(fluoromethyl)-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 163281639 |
| Molecular Formula | C13H22FN3O2 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 6-(fluoromethyl)-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CCC(C)CN1CC2NCCC(=O)N2C(CF)C1=O |
| InChI | InChI=1S/C13H22FN3O2/c1-3-9(2)7-16-8-11-15-5-4-12(18)17(11)10(6-14)13(16)19/h9-11,15H,3-8H2,1-2H3 |
| InChIKey | OTBMPQMCNZFOKZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |