C9H16N4O2 — CID 78199743
6,7,8-trimethyl-1,4a,5,6,7,8a-hexahydropteridine-2,4-dione (PubChem CID 78199743) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 6,7,8-trimethyl-1,4a,5,6,7,8a-hexahydropteridine-2,4-dione.
| Compound Name | 6,7,8-trimethyl-1,4a,5,6,7,8a-hexahydropteridine-2,4-dione |
|---|---|
| PubChem CID | 78199743 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6,7,8-trimethyl-1,4a,5,6,7,8a-hexahydropteridine-2,4-dione |
| SMILES | CC1NC2C(=O)NC(=O)NC2N(C)C1C |
| InChI | InChI=1S/C9H16N4O2/c1-4-5(2)13(3)7-6(10-4)8(14)12-9(15)11-7/h4-7,10H,1-3H3,(H2,11,12,14,15) |
| InChIKey | SRVLBOADGXVPPO-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |