C12H21N3O2 — CID 22086768
1,2,3,6,8-pentamethyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 22086768) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1,2,3,6,8-pentamethyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 1,2,3,6,8-pentamethyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 22086768 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1,2,3,6,8-pentamethyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC1C(=O)N2C(C)C(=O)N(C)CC2N(C)C1C |
| InChI | InChI=1S/C12H21N3O2/c1-7-8(2)14(5)10-6-13(4)12(17)9(3)15(10)11(7)16/h7-10H,6H2,1-5H3 |
| InChIKey | OXFNLANEWLGLPA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |