C28H23N5O3 — CID 163286136
1-[1-(4-nitrophenyl)ethyl]-2,4,6-triphenyl-1,2,4,5-tetrazin-3-one (PubChem CID 163286136) has the molecular formula C28H23N5O3 and a molecular weight of 477.52 g/mol. Its IUPAC name is 1-[1-(4-nitrophenyl)ethyl]-2,4,6-triphenyl-1,2,4,5-tetrazin-3-one.
| Compound Name | 1-[1-(4-nitrophenyl)ethyl]-2,4,6-triphenyl-1,2,4,5-tetrazin-3-one |
|---|---|
| PubChem CID | 163286136 |
| Molecular Formula | C28H23N5O3 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[1-(4-nitrophenyl)ethyl]-2,4,6-triphenyl-1,2,4,5-tetrazin-3-one |
| SMILES | CC(c1ccc([N+](=O)[O-])cc1)N1C(c2ccccc2)=NN(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H23N5O3/c1-21(22-17-19-26(20-18-22)33(35)36)31-27(23-11-5-2-6-12-23)29-30(24-13-7-3-8-14-24)28(34)32(31)25-15-9-4-10-16-25/h2-21H,1H3 |
| InChIKey | BYPAPMBPBVILLK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|