C15H16F3N5O2S — CID 163290531
2-methylsulfonyl-6-piperazin-1-yl-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 163290531) has the molecular formula C15H16F3N5O2S and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-methylsulfonyl-6-piperazin-1-yl-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 2-methylsulfonyl-6-piperazin-1-yl-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 163290531 |
| Molecular Formula | C15H16F3N5O2S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-methylsulfonyl-6-piperazin-1-yl-N-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1nc(Nc2cc(F)c(F)c(F)c2)cc(N2CCNCC2)n1 |
| InChI | InChI=1S/C15H16F3N5O2S/c1-26(24,25)15-21-12(8-13(22-15)23-4-2-19-3-5-23)20-9-6-10(16)14(18)11(17)7-9/h6-8,19H,2-5H2,1H3,(H,20,21,22) |
| InChIKey | MXILXJHYRCMVAF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|