C15H17ClFN5O2S — CID 163290509
N-(3-chloro-4-fluorophenyl)-2-methylsulfonyl-6-piperazin-1-ylpyrimidin-4-amine (PubChem CID 163290509) has the molecular formula C15H17ClFN5O2S and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-methylsulfonyl-6-piperazin-1-ylpyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-methylsulfonyl-6-piperazin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 163290509 |
| Molecular Formula | C15H17ClFN5O2S |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-methylsulfonyl-6-piperazin-1-ylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1nc(Nc2ccc(F)c(Cl)c2)cc(N2CCNCC2)n1 |
| InChI | InChI=1S/C15H17ClFN5O2S/c1-25(23,24)15-20-13(19-10-2-3-12(17)11(16)8-10)9-14(21-15)22-6-4-18-5-7-22/h2-3,8-9,18H,4-7H2,1H3,(H,19,20,21) |
| InChIKey | MQYAKSGFVTXHGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |