C16H19ClFN5O2S — CID 163290524
6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)-2-methylsulfonylpyrimidin-4-amine (PubChem CID 163290524) has the molecular formula C16H19ClFN5O2S and a molecular weight of 399.88 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)-2-methylsulfonylpyrimidin-4-amine.
| Compound Name | 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)-2-methylsulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 163290524 |
| Molecular Formula | C16H19ClFN5O2S |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)-N-(3-chloro-4-fluorophenyl)-2-methylsulfonylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1nc(Nc2ccc(F)c(Cl)c2)cc(N2CCC(N)CC2)n1 |
| InChI | InChI=1S/C16H19ClFN5O2S/c1-26(24,25)16-21-14(20-11-2-3-13(18)12(17)8-11)9-15(22-16)23-6-4-10(19)5-7-23/h2-3,8-10H,4-7,19H2,1H3,(H,20,21,22) |
| InChIKey | BFZTWCPNCBZXBN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |