C17H14F2N4O2S — CID 163290536
4-N,6-N-bis(4-fluorophenyl)-2-methylsulfonylpyrimidine-4,6-diamine (PubChem CID 163290536) has the molecular formula C17H14F2N4O2S and a molecular weight of 376.39 g/mol. Its IUPAC name is 4-N,6-N-bis(4-fluorophenyl)-2-methylsulfonylpyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(4-fluorophenyl)-2-methylsulfonylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 163290536 |
| Molecular Formula | C17H14F2N4O2S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-N,6-N-bis(4-fluorophenyl)-2-methylsulfonylpyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1nc(Nc2ccc(F)cc2)cc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H14F2N4O2S/c1-26(24,25)17-22-15(20-13-6-2-11(18)3-7-13)10-16(23-17)21-14-8-4-12(19)5-9-14/h2-10H,1H3,(H2,20,21,22,23) |
| InChIKey | GSOYKVABHQNMSF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |