About ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine
ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine (PubChem CID 163291135) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine.
Molecular Properties
| Compound Name | ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine |
| PubChem CID | 163291135 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine |
| SMILES | C=C(C)/C(=C/C(C)C)CCN(C)C.CC |
| InChI | InChI=1S/C12H23N.C2H6/c1-10(2)9-12(11(3)4)7-8-13(5)6;1-2/h9-10H,3,7-8H2,1-2,4-6H3;1-2H3/b12-9+; |
| InChIKey | SSNZKLCQPZVKSL-NBYYMMLRSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine?
The IUPAC name of ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine (CID 163291135) is ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine.
What is the SMILES notation for ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine?
The canonical SMILES for ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine is C=C(C)/C(=C/C(C)C)CCN(C)C.CC.
What is the InChIKey of ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine?
The InChIKey is SSNZKLCQPZVKSL-NBYYMMLRSA-N. The full InChI is InChI=1S/C12H23N.C2H6/c1-10(2)9-12(11(3)4)7-8-13(5)6;1-2/h9-10H,3,7-8H2,1-2,4-6H3;1-2H3/b12-9+;.
What are the key properties of ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine?
ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine has a molecular weight of 211.39 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine is sourced from PubChem (CID 163291135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).