C14H29N — CID 163291135
ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine (PubChem CID 163291135) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine.
| Compound Name | ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine |
|---|---|
| PubChem CID | 163291135 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(E)-N,N,5-trimethyl-3-prop-1-en-2-ylhex-3-en-1-amine |
| SMILES | C=C(C)/C(=C/C(C)C)CCN(C)C.CC |
| InChI | InChI=1S/C12H23N.C2H6/c1-10(2)9-12(11(3)4)7-8-13(5)6;1-2/h9-10H,3,7-8H2,1-2,4-6H3;1-2H3/b12-9+; |
| InChIKey | SSNZKLCQPZVKSL-NBYYMMLRSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|