C15H28N2 — CID 146182677
(Z)-N,N',N'-trimethyl-2-[(2Z)-penta-2,4-dien-2-yl]-N-propan-2-ylbut-1-ene-1,4-diamine (PubChem CID 146182677) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (Z)-N,N',N'-trimethyl-2-[(2Z)-penta-2,4-dien-2-yl]-N-propan-2-ylbut-1-ene-1,4-diamine.
| Compound Name | (Z)-N,N',N'-trimethyl-2-[(2Z)-penta-2,4-dien-2-yl]-N-propan-2-ylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 146182677 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (Z)-N,N',N'-trimethyl-2-[(2Z)-penta-2,4-dien-2-yl]-N-propan-2-ylbut-1-ene-1,4-diamine |
| SMILES | C=C/C=C(C)\C(=C/N(C)C(C)C)CCN(C)C |
| InChI | InChI=1S/C15H28N2/c1-8-9-14(4)15(10-11-16(5)6)12-17(7)13(2)3/h8-9,12-13H,1,10-11H2,2-7H3/b14-9-,15-12- |
| InChIKey | FMZXUZAESBRULQ-KCYOALMLSA-N |
| XLogP | 3.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|