C11H14N2S — CID 163292387
2-ethyl-7-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 163292387) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-ethyl-7-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-ethyl-7-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 163292387 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-ethyl-7-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CCc1nc2c(C(C)C)ccnc2s1 |
| InChI | InChI=1S/C11H14N2S/c1-4-9-13-10-8(7(2)3)5-6-12-11(10)14-9/h5-7H,4H2,1-3H3 |
| InChIKey | KNDJGKZADCMYNB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |