About N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 133335762) has the molecular formula C14H15N3S2
and a molecular weight of 289.43 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine |
| PubChem CID | 133335762 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | CCc1cnc(C(C)Nc2ccnc3ccsc23)s1 |
| InChI | InChI=1S/C14H15N3S2/c1-3-10-8-16-14(19-10)9(2)17-12-4-6-15-11-5-7-18-13(11)12/h4-9H,3H2,1-2H3,(H,15,17) |
| InChIKey | LSSHAHFFMKHOQH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine?
The IUPAC name of N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine (CID 133335762) is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine?
The canonical SMILES for N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine is CCc1cnc(C(C)Nc2ccnc3ccsc23)s1.
What is the InChIKey of N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine?
The InChIKey is LSSHAHFFMKHOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3S2/c1-3-10-8-16-14(19-10)9(2)17-12-4-6-15-11-5-7-18-13(11)12/h4-9H,3H2,1-2H3,(H,15,17).
What are the key properties of N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine?
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine has a molecular weight of 289.43 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]thieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 133335762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).