C10H12N2OS — CID 130653771
(2R)-1-(thieno[3,2-b]pyridin-7-ylamino)propan-2-ol (PubChem CID 130653771) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is (2R)-1-(thieno[3,2-b]pyridin-7-ylamino)propan-2-ol.
| Compound Name | (2R)-1-(thieno[3,2-b]pyridin-7-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 130653771 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2R)-1-(thieno[3,2-b]pyridin-7-ylamino)propan-2-ol |
| SMILES | C[C@@H](O)CNc1ccnc2ccsc12 |
| InChI | InChI=1S/C10H12N2OS/c1-7(13)6-12-8-2-4-11-9-3-5-14-10(8)9/h2-5,7,13H,6H2,1H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | ZCMIIQAEVHUXRA-SSDOTTSWSA-N |
| XLogP | 2.09 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |