C15H15N3O2S2 — CID 71871497
4-[2-(thieno[3,2-b]pyridin-7-ylamino)ethyl]benzenesulfonamide (PubChem CID 71871497) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-[2-(thieno[3,2-b]pyridin-7-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(thieno[3,2-b]pyridin-7-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71871497 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-[2-(thieno[3,2-b]pyridin-7-ylamino)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ccnc3ccsc23)cc1 |
| InChI | InChI=1S/C15H15N3O2S2/c16-22(19,20)12-3-1-11(2-4-12)5-8-17-13-6-9-18-14-7-10-21-15(13)14/h1-4,6-7,9-10H,5,8H2,(H,17,18)(H2,16,19,20) |
| InChIKey | VJCIBJMSUIIDEA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |