C20H24F2O5S2 — CID 163297652
[6-(benzenesulfonyl)-6,6-difluoro-5-methylhexyl] 4-methylbenzenesulfonate (PubChem CID 163297652) has the molecular formula C20H24F2O5S2 and a molecular weight of 446.54 g/mol. Its IUPAC name is [6-(benzenesulfonyl)-6,6-difluoro-5-methylhexyl] 4-methylbenzenesulfonate.
| Compound Name | [6-(benzenesulfonyl)-6,6-difluoro-5-methylhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163297652 |
| Molecular Formula | C20H24F2O5S2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [6-(benzenesulfonyl)-6,6-difluoro-5-methylhexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC(C)C(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24F2O5S2/c1-16-11-13-19(14-12-16)29(25,26)27-15-7-6-8-17(2)20(21,22)28(23,24)18-9-4-3-5-10-18/h3-5,9-14,17H,6-8,15H2,1-2H3 |
| InChIKey | QOKQQDWCLCKKGC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|