C19H16F6O2S — CID 163297672
[5,5-difluoro-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentyl] 4-methylbenzoate (PubChem CID 163297672) has the molecular formula C19H16F6O2S and a molecular weight of 422.39 g/mol. Its IUPAC name is [5,5-difluoro-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentyl] 4-methylbenzoate.
| Compound Name | [5,5-difluoro-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163297672 |
| Molecular Formula | C19H16F6O2S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [5,5-difluoro-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCCCC(F)(F)Sc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C19H16F6O2S/c1-11-4-6-12(7-5-11)18(26)27-9-3-2-8-19(24,25)28-17-15(22)13(20)10-14(21)16(17)23/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | YXSQXZVRVBASFD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|