C18H15F2N7 — CID 163302603
2,4-difluoro-3-(3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaen-8-yl)benzonitrile;ethane (PubChem CID 163302603) has the molecular formula C18H15F2N7 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2,4-difluoro-3-(3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaen-8-yl)benzonitrile;ethane.
| Compound Name | 2,4-difluoro-3-(3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaen-8-yl)benzonitrile;ethane |
|---|---|
| PubChem CID | 163302603 |
| Molecular Formula | C18H15F2N7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2,4-difluoro-3-(3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaen-8-yl)benzonitrile;ethane |
| SMILES | CC.N#Cc1ccc(F)c(C2=Nc3cn[nH]c3-c3cnn4c3N2CC4)c1F |
| InChI | InChI=1S/C16H9F2N7.C2H6/c17-10-2-1-8(5-19)13(18)12(10)15-22-11-7-20-23-14(11)9-6-21-25-4-3-24(15)16(9)25;1-2/h1-2,6-7H,3-4H2,(H,20,23);1-2H3 |
| InChIKey | IDYLUHREMNTGLU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |