C10H13N3O2 — CID 163304613
1-[(1S,6S)-1,2,3,4,5,6-hexadeuteriocyclohexa-2,4-dien-1-yl]-2,4-dimethyl-1,2,4-triazolidine-3,5-dione (PubChem CID 163304613) has the molecular formula C10H13N3O2 and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-[(1S,6S)-1,2,3,4,5,6-hexadeuteriocyclohexa-2,4-dien-1-yl]-2,4-dimethyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-[(1S,6S)-1,2,3,4,5,6-hexadeuteriocyclohexa-2,4-dien-1-yl]-2,4-dimethyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 163304613 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-[(1S,6S)-1,2,3,4,5,6-hexadeuteriocyclohexa-2,4-dien-1-yl]-2,4-dimethyl-1,2,4-triazolidine-3,5-dione |
| SMILES | [2H]C1=C([2H])[C@H]([2H])[C@]([2H])(n2c(=O)n(C)c(=O)n2C)C([2H])=C1[2H] |
| InChI | InChI=1S/C10H13N3O2/c1-11-9(14)12(2)13(10(11)15)8-6-4-3-5-7-8/h3-6,8H,7H2,1-2H3/t8-/m1/s1/i3D,4D,5D,6D,7D,8D/t7-,8+/m0 |
| InChIKey | KFIAMYDGXNWTNY-ZRASPYELSA-N |
| XLogP | -0.06 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |