C19H26ClFN2O2 — CID 163310708
(3aS,6aS)-4-[(2-chloro-4-fluorophenyl)methyl]-1-(1,4-dioxepan-6-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 163310708) has the molecular formula C19H26ClFN2O2 and a molecular weight of 368.88 g/mol. Its IUPAC name is (3aS,6aS)-4-[(2-chloro-4-fluorophenyl)methyl]-1-(1,4-dioxepan-6-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aS,6aS)-4-[(2-chloro-4-fluorophenyl)methyl]-1-(1,4-dioxepan-6-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 163310708 |
| Molecular Formula | C19H26ClFN2O2 |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3aS,6aS)-4-[(2-chloro-4-fluorophenyl)methyl]-1-(1,4-dioxepan-6-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Fc1ccc(CN2CC[C@H]3[C@@H]2CCN3CC2COCCOC2)c(Cl)c1 |
| InChI | InChI=1S/C19H26ClFN2O2/c20-17-9-16(21)2-1-15(17)11-23-6-4-18-19(23)3-5-22(18)10-14-12-24-7-8-25-13-14/h1-2,9,14,18-19H,3-8,10-13H2/t18-,19-/m0/s1 |
| InChIKey | NZYGQWNRVSJJHN-OALUTQOASA-N |
| XLogP | 2.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |