C17H24ClFN2O2 — CID 97234657
(2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethanamine (PubChem CID 97234657) has the molecular formula C17H24ClFN2O2 and a molecular weight of 342.84 g/mol. Its IUPAC name is (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethanamine.
| Compound Name | (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethanamine |
|---|---|
| PubChem CID | 97234657 |
| Molecular Formula | C17H24ClFN2O2 |
| Molecular Weight | 342.84 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2R)-N-[(2-chloro-4-fluorophenyl)methyl]-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethanamine |
| SMILES | Fc1ccc(CNC[C@@H]([C@@H]2CCOC2)N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H24ClFN2O2/c18-16-9-15(19)2-1-13(16)10-20-11-17(14-3-6-23-12-14)21-4-7-22-8-5-21/h1-2,9,14,17,20H,3-8,10-12H2/t14-,17+/m1/s1 |
| InChIKey | ZIGIZXWOJGLKPK-PBHICJAKSA-N |
| XLogP | 2.31 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.84 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |