C16H16BrN3OS2 — CID 163329145
2-[2-amino-5-(2-phenylethyl)-1,3,4-thiadiazol-3-ium-3-yl]-1-thiophen-2-ylethanone bromide (PubChem CID 163329145) has the molecular formula C16H16BrN3OS2 and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-[2-amino-5-(2-phenylethyl)-1,3,4-thiadiazol-3-ium-3-yl]-1-thiophen-2-ylethanone bromide.
| Compound Name | 2-[2-amino-5-(2-phenylethyl)-1,3,4-thiadiazol-3-ium-3-yl]-1-thiophen-2-ylethanone bromide |
|---|---|
| PubChem CID | 163329145 |
| Molecular Formula | C16H16BrN3OS2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[2-amino-5-(2-phenylethyl)-1,3,4-thiadiazol-3-ium-3-yl]-1-thiophen-2-ylethanone bromide |
| SMILES | Nc1sc(CCc2ccccc2)n[n+]1CC(=O)c1cccs1.[Br-] |
| InChI | InChI=1S/C16H15N3OS2.BrH/c17-16-19(11-13(20)14-7-4-10-21-14)18-15(22-16)9-8-12-5-2-1-3-6-12;/h1-7,10,17H,8-9,11H2;1H |
| InChIKey | QDJKBMYTQPNZQE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 59.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|