C12H14N3OS+ — CID 2305252
2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-phenylethanone (PubChem CID 2305252) has the molecular formula C12H14N3OS+ and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-phenylethanone.
| Compound Name | 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 2305252 |
| Molecular Formula | C12H14N3OS+ |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-phenylethanone |
| SMILES | CCc1n[n+](CC(=O)c2ccccc2)c(N)s1 |
| InChI | InChI=1S/C12H13N3OS/c1-2-11-14-15(12(13)17-11)8-10(16)9-6-4-3-5-7-9/h3-7,13H,2,8H2,1H3/p+1 |
| InChIKey | HKXXHBVHHUSSCR-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 59.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|