C22H25ClN2O7 — CID 163331245
4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;hydrochloride (PubChem CID 163331245) has the molecular formula C22H25ClN2O7 and a molecular weight of 464.90 g/mol. Its IUPAC name is 4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;hydrochloride.
| Compound Name | 4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163331245 |
| Molecular Formula | C22H25ClN2O7 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;hydrochloride |
| SMILES | CC1c2cccc(O)c2C(O)=C2C(=O)C3C(=O)C(C(N)=O)=C(O)C(N(C)C)C3C(O)C21.Cl |
| InChI | InChI=1S/C22H24N2O7.ClH/c1-7-8-5-4-6-9(25)11(8)18(27)13-10(7)17(26)12-14(19(13)28)20(29)15(22(23)31)21(30)16(12)24(2)3;/h4-7,10,12,14,16-17,25-27,30H,1-3H3,(H2,23,31);1H |
| InChIKey | SNGNMRYMVWKFKA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|