C27H27N3O7 — CID 163845288
(4S,4aR,5S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-pyridin-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 163845288) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is (4S,4aR,5S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-pyridin-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-pyridin-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 163845288 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (4S,4aR,5S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methyl-1,12-dioxo-9-pyridin-2-yl-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1c2ccc(-c3ccccn3)c(O)c2C(O)=C2C(=O)C3C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C27H27N3O7/c1-10-11-7-8-12(13-6-4-5-9-29-13)21(31)15(11)23(33)17-14(10)22(32)16-18(24(17)34)25(35)19(27(28)37)26(36)20(16)30(2)3/h4-10,14,16,18,20,22,31-33,36H,1-3H3,(H2,28,37)/t10?,14-,16-,18?,20+,22+/m1/s1 |
| InChIKey | BSEJHZTXRPTHSL-DYYHOZIDSA-N |
| XLogP | 1.44 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|