C22H22N2O8 — CID 167070184
amino (4S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methylidene-1,12-dioxo-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxylate (PubChem CID 167070184) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is amino (4S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methylidene-1,12-dioxo-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxylate.
| Compound Name | amino (4S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methylidene-1,12-dioxo-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxylate |
|---|---|
| PubChem CID | 167070184 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | amino (4S,5aR)-4-(dimethylamino)-3,5,10,11-tetrahydroxy-6-methylidene-1,12-dioxo-4a,5,5a,12a-tetrahydro-4H-tetracene-2-carboxylate |
| SMILES | C=C1c2cccc(O)c2C(O)=C2C(=O)C3C(=O)C(C(=O)ON)=C(O)[C@@H](N(C)C)C3C(O)[C@H]12 |
| InChI | InChI=1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)18(27)13-10(7)17(26)12-14(19(13)28)20(29)15(22(31)32-23)21(30)16(12)24(2)3/h4-6,10,12,14,16-17,25-27,30H,1,23H2,2-3H3/t10-,12?,14?,16+,17?/m1/s1 |
| InChIKey | XOBJFAOYOHARAH-YZHGELCVSA-N |
| XLogP | 0.22 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|