C23H26N4O9 — CID 54681080
4,7-bis(dimethylamino)-3,5,10,11-tetrahydroxy-9-nitro-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 54681080) has the molecular formula C23H26N4O9 and a molecular weight of 502.48 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-3,5,10,11-tetrahydroxy-9-nitro-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-3,5,10,11-tetrahydroxy-9-nitro-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681080 |
| Molecular Formula | C23H26N4O9 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 4,7-bis(dimethylamino)-3,5,10,11-tetrahydroxy-9-nitro-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc([N+](=O)[O-])c(O)c2c1CC1C(=C2O)C(=O)C2C(=O)C(C(N)=O)=C(O)C(N(C)C)C2C1O |
| InChI | InChI=1S/C23H26N4O9/c1-25(2)9-6-10(27(35)36)18(29)11-7(9)5-8-12(19(11)30)20(31)14-13(17(8)28)16(26(3)4)22(33)15(21(14)32)23(24)34/h6,8,13-14,16-17,28-30,33H,5H2,1-4H3,(H2,24,34) |
| InChIKey | XBJPFJFYTNFCLH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 207.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|