C25H29N3O10 — CID 91802028
(4R,4aS,5R,5aS,12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-7-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91802028) has the molecular formula C25H29N3O10 and a molecular weight of 531.52 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-7-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-7-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91802028 |
| Molecular Formula | C25H29N3O10 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (4R,4aS,5R,5aS,12aS)-9-tert-butyl-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-7-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)c(C(C)(C)C)cc([N+](=O)[O-])c4C[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C25H29N3O10/c1-24(2,3)10-7-11(28(37)38)8-6-9-13(19(31)12(8)18(10)30)21(33)25(36)15(17(9)29)16(27(4)5)20(32)14(22(25)34)23(26)35/h7,9,15-17,29-31,34,36H,6H2,1-5H3,(H2,26,35)/t9-,15-,16+,17+,25+/m0/s1 |
| InChIKey | QLCVZGACZWSURP-CCAMKTKFSA-N |
| XLogP | 0.14 |
| TPSA | 224.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|