C23H28N2O7 — CID 90802317
(4S,4aR,5S,5aR,12aR)-4-(dimethylamino)-1,5,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane (PubChem CID 90802317) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,12aR)-4-(dimethylamino)-1,5,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane.
| Compound Name | (4S,4aR,5S,5aR,12aR)-4-(dimethylamino)-1,5,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 90802317 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (4S,4aR,5S,5aR,12aR)-4-(dimethylamino)-1,5,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;ethane |
| SMILES | CC.CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4ccccc4C[C@H]3[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C21H22N2O7.C2H6/c1-23(2)14-13-16(25)10-7-8-5-3-4-6-9(8)15(24)11(10)18(27)21(13,30)19(28)12(17(14)26)20(22)29;1-2/h3-6,10,13-14,16,24-25,28,30H,7H2,1-2H3,(H2,22,29);1-2H3/t10-,13-,14+,16+,21+;/m1./s1 |
| InChIKey | COJPNGLMJHCZQO-XHKGQUBDSA-N |
| XLogP | 0.26 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|