C22H26N2O8 — CID 175153846
(4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,10,12,12-pentahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 175153846) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,10,12,12-pentahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,10,12,12-pentahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 175153846 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (4S,4aR,5S,5aR,6S,12aR)-4-(dimethylamino)-1,5,10,12,12-pentahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@@H]1c2cccc(O)c2C(=O)C2[C@@H]1[C@H](O)[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@H]1C2(O)O |
| InChI | InChI=1S/C22H26N2O8/c1-7-8-5-4-6-9(25)11(8)18(27)14-10(7)17(26)12-15(22(14,31)32)19(28)13(21(23)30)20(29)16(12)24(2)3/h4-7,10,12,14-17,25-26,28,31-32H,1-3H3,(H2,23,30)/t7-,10-,12-,14?,15-,16+,17+/m1/s1 |
| InChIKey | ONRGRHMFXKHVBM-DXAPBXQQSA-N |
| XLogP | -0.98 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|