C22H26N2O7 — CID 54686995
(4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,12a-tetrahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 54686995) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,12a-tetrahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,12a-tetrahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54686995 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,12a-tetrahydroxy-6-methyl-3,11-dioxo-4a,5,5a,6,11a,12-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1c2cccc(O)c2C(=O)C2C[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C22H26N2O7/c1-8-9-5-4-6-11(25)13(9)17(26)10-7-22(31)15(18(27)12(8)10)16(24(2)3)19(28)14(20(22)29)21(23)30/h4-6,8,10,12,15-16,18,25,27,29,31H,7H2,1-3H3,(H2,23,30)/t8?,10?,12?,15?,16-,18?,22+/m0/s1 |
| InChIKey | WODGYNNPEAPBAD-RKLMQHRASA-N |
| XLogP | -0.15 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|