C20H24N6O4S — CID 163337704
bis((4-pyrazol-1-ylphenyl)methanamine);sulfuric acid (PubChem CID 163337704) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is bis((4-pyrazol-1-ylphenyl)methanamine);sulfuric acid.
| Compound Name | bis((4-pyrazol-1-ylphenyl)methanamine);sulfuric acid |
|---|---|
| PubChem CID | 163337704 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | bis((4-pyrazol-1-ylphenyl)methanamine);sulfuric acid |
| SMILES | NCc1ccc(-n2cccn2)cc1.NCc1ccc(-n2cccn2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H11N3.H2O4S/c2*11-8-9-2-4-10(5-3-9)13-7-1-6-12-13;1-5(2,3)4/h2*1-7H,8,11H2;(H2,1,2,3,4) |
| InChIKey | NOAJCKSXCGOLLU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|