C7H14ClNO — CID 163337889
(2S,3aS,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole;hydrochloride (PubChem CID 163337889) has the molecular formula C7H14ClNO and a molecular weight of 163.65 g/mol. Its IUPAC name is (2S,3aS,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole;hydrochloride.
| Compound Name | (2S,3aS,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 163337889 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2S,3aS,6aS)-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole;hydrochloride |
| SMILES | C[C@H]1C[C@H]2CNC[C@H]2O1.Cl |
| InChI | InChI=1S/C7H13NO.ClH/c1-5-2-6-3-8-4-7(6)9-5;/h5-8H,2-4H2,1H3;1H/t5-,6-,7+;/m0./s1 |
| InChIKey | JBIOQMTUESIJOM-LBZPYWGZSA-N |
| XLogP | 0.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |