C8H14N2O — CID 146275623
(5S)-6-(3-methyloxiran-2-yl)-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 146275623) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (5S)-6-(3-methyloxiran-2-yl)-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | (5S)-6-(3-methyloxiran-2-yl)-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 146275623 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (5S)-6-(3-methyloxiran-2-yl)-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CC1OC1N1C2CNC[C@@H]1C2 |
| InChI | InChI=1S/C8H14N2O/c1-5-8(11-5)10-6-2-7(10)4-9-3-6/h5-9H,2-4H2,1H3/t5?,6-,7?,8?/m0/s1 |
| InChIKey | IBRQVOLFALCWMD-GGRBJAFOSA-N |
| XLogP | -0.22 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|