C22H33N5O5 — CID 163340654
[(4aR,6S,8aR)-4-(1H-imidazole-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-6-yl]-[(1S,5R)-6-[(dimethylamino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone;formic acid (PubChem CID 163340654) has the molecular formula C22H33N5O5 and a molecular weight of 447.54 g/mol. Its IUPAC name is [(4aR,6S,8aR)-4-(1H-imidazole-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-6-yl]-[(1S,5R)-6-[(dimethylamino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone;formic acid.
| Compound Name | [(4aR,6S,8aR)-4-(1H-imidazole-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-6-yl]-[(1S,5R)-6-[(dimethylamino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 163340654 |
| Molecular Formula | C22H33N5O5 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | [(4aR,6S,8aR)-4-(1H-imidazole-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-6-yl]-[(1S,5R)-6-[(dimethylamino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone;formic acid |
| SMILES | CN(C)CC1[C@H]2CN(C(=O)[C@H]3CC[C@H]4OCCN(C(=O)c5ncc[nH]5)[C@@H]4C3)C[C@@H]12.O=CO |
| InChI | InChI=1S/C21H31N5O3.CH2O2/c1-24(2)10-14-15-11-25(12-16(14)15)20(27)13-3-4-18-17(9-13)26(7-8-29-18)21(28)19-22-5-6-23-19;2-1-3/h5-6,13-18H,3-4,7-12H2,1-2H3,(H,22,23);1H,(H,2,3)/t13-,14?,15-,16+,17+,18+;/m0./s1 |
| InChIKey | ASKBKQDZHCDGOD-ZVJJXPFJSA-N |
| XLogP | 0.39 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|