C18H24N4O2 — CID 163341544
formic acid;1-(piperidin-1-ylmethyl)-5,10-dihydro-4H-[1,2,4]triazolo[4,3-b][2]benzazepine (PubChem CID 163341544) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is formic acid;1-(piperidin-1-ylmethyl)-5,10-dihydro-4H-[1,2,4]triazolo[4,3-b][2]benzazepine.
| Compound Name | formic acid;1-(piperidin-1-ylmethyl)-5,10-dihydro-4H-[1,2,4]triazolo[4,3-b][2]benzazepine |
|---|---|
| PubChem CID | 163341544 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | formic acid;1-(piperidin-1-ylmethyl)-5,10-dihydro-4H-[1,2,4]triazolo[4,3-b][2]benzazepine |
| SMILES | O=CO.c1ccc2c(c1)CCc1nnc(CN3CCCCC3)n1C2 |
| InChI | InChI=1S/C17H22N4.CH2O2/c1-4-10-20(11-5-1)13-17-19-18-16-9-8-14-6-2-3-7-15(14)12-21(16)17;2-1-3/h2-3,6-7H,1,4-5,8-13H2;1H,(H,2,3) |
| InChIKey | BILBDVOEKZGRPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|