C9H9N2NaO3S — CID 163343256
sodium 1,3-dimethyl-5-sulfinatobenzimidazol-2-one (PubChem CID 163343256) has the molecular formula C9H9N2NaO3S and a molecular weight of 248.24 g/mol. Its IUPAC name is sodium 1,3-dimethyl-5-sulfinatobenzimidazol-2-one.
| Compound Name | sodium 1,3-dimethyl-5-sulfinatobenzimidazol-2-one |
|---|---|
| PubChem CID | 163343256 |
| Molecular Formula | C9H9N2NaO3S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | sodium 1,3-dimethyl-5-sulfinatobenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc([S-](=O)=O)ccc21.[Na+] |
| InChI | InChI=1S/C9H9N2O3S.Na/c1-10-7-4-3-6(15(13)14)5-8(7)11(2)9(10)12;/h3-5H,1-2H3;/q-1;+1 |
| InChIKey | JRYMYMVNKSQTMW-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|