C15H19FN6 — CID 163347891
5-(3-fluoro-2-pyridinyl)-2-[2-(triazol-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 163347891) has the molecular formula C15H19FN6 and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-(3-fluoro-2-pyridinyl)-2-[2-(triazol-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(3-fluoro-2-pyridinyl)-2-[2-(triazol-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163347891 |
| Molecular Formula | C15H19FN6 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-(3-fluoro-2-pyridinyl)-2-[2-(triazol-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cccnc1N1CC2CN(CCn3ccnn3)CC2C1 |
| InChI | InChI=1S/C15H19FN6/c16-14-2-1-3-17-15(14)21-10-12-8-20(9-13(12)11-21)6-7-22-5-4-18-19-22/h1-5,12-13H,6-11H2 |
| InChIKey | CLOZYAWEWYDDBH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |