C18H20ClN5O — CID 163350026
N-(3-chlorophenyl)-2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 163350026) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 163350026 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1cc(N2CC3CN(C(=O)Nc4cccc(Cl)c4)CC3C2)ncn1 |
| InChI | InChI=1S/C18H20ClN5O/c1-12-5-17(21-11-20-12)23-7-13-9-24(10-14(13)8-23)18(25)22-16-4-2-3-15(19)6-16/h2-6,11,13-14H,7-10H2,1H3,(H,22,25) |
| InChIKey | HOLIXNSKFODUNX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |