C25H40 — CID 163358943
(2R,3S,6R,7R,10R,13S,16S,17R)-2,6,10,13-tetramethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadec-1(11)-ene (PubChem CID 163358943) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (2R,3S,6R,7R,10R,13S,16S,17R)-2,6,10,13-tetramethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadec-1(11)-ene.
| Compound Name | (2R,3S,6R,7R,10R,13S,16S,17R)-2,6,10,13-tetramethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadec-1(11)-ene |
|---|---|
| PubChem CID | 163358943 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (2R,3S,6R,7R,10R,13S,16S,17R)-2,6,10,13-tetramethyl-16-propan-2-ylpentacyclo[9.7.0.02,7.03,7.013,17]octadec-1(11)-ene |
| SMILES | CC(C)[C@@H]1CC[C@@]2(C)CC3=C(C[C@H]12)[C@]1(C)[C@H]2CC[C@@H](C)[C@]21CC[C@H]3C |
| InChI | InChI=1S/C25H40/c1-15(2)18-10-11-23(5)14-19-16(3)9-12-25-17(4)7-8-22(25)24(25,6)21(19)13-20(18)23/h15-18,20,22H,7-14H2,1-6H3/t16-,17-,18+,20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | ZUDOUHDDSIJHEB-IGCMXNHPSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|